CymitQuimica logo

CAS 850429-65-1

:

3-bromo-N-ethyl-4-methylbenzenesulfonamide

Description:
3-Bromo-N-ethyl-4-methylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the 3-position of the benzene ring and an ethyl group attached to the nitrogen of the sulfonamide contributes to its unique chemical reactivity and potential biological activity. The methyl group at the 4-position further influences its steric and electronic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the sulfonamide group, which can engage in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as sulfonamides are often used as antibiotics. Additionally, the bromine substituent may enhance its reactivity in various chemical reactions, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and environmental impact.
Formula:C9H12BrNO2S
InChI:InChI=1/C9H12BrNO2S/c1-3-11-14(12,13)8-5-4-7(2)9(10)6-8/h4-6,11H,3H2,1-2H3
SMILES:CCNS(=O)(=O)c1ccc(C)c(c1)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.