CAS 850429-70-8
:3-Bromo-N-(1,1-dimethylethyl)-4-methylbenzenesulfonamide
Description:
3-Bromo-N-(1,1-dimethylethyl)-4-methylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the 3-position of the aromatic ring contributes to its reactivity and potential applications in medicinal chemistry. The N-(1,1-dimethylethyl) substituent indicates a bulky tert-butyl group, which can influence the compound's steric properties and solubility. The 4-methyl group on the benzene ring enhances the compound's lipophilicity, potentially affecting its biological activity and interaction with target proteins. This compound may be utilized in various chemical syntheses or as a building block in drug development due to its unique structural features. Additionally, the sulfonamide moiety is often associated with a range of biological activities, making this compound of interest in pharmaceutical research. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C11H16BrNO2S
InChI:InChI=1S/C11H16BrNO2S/c1-8-5-6-9(7-10(8)12)16(14,15)13-11(2,3)4/h5-7,13H,1-4H3
InChI key:InChIKey=GZGHIWXQPZQUHK-UHFFFAOYSA-N
SMILES:S(NC(C)(C)C)(=O)(=O)C1=CC(Br)=C(C)C=C1
Synonyms:- 3-Bromo-N-tert-butyl-4-methylbenzene-1-sulfonamide
- Benzenesulfonamide, 3-bromo-N-(1,1-dimethylethyl)-4-methyl-
- 3-Bromo-N-(1,1-dimethylethyl)-4-methylbenzenesulfonamide
- 3-Bromo-N-(tert-butyl)-4-methylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
