CAS 850429-71-9
:3-bromo-N,N-diethyl-4-methylbenzenesulfonamide
Description:
3-Bromo-N,N-diethyl-4-methylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a bromine atom at the 3-position of the aromatic ring and two ethyl groups attached to the nitrogen of the sulfonamide contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the ethyl groups and the aromatic ring. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as sulfonamides are often used as antibiotics. Additionally, the presence of the bromine atom may enhance its reactivity in various chemical reactions, making it a useful intermediate in organic synthesis. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.
Formula:C11H16BrNO2S
InChI:InChI=1/C11H16BrNO2S/c1-4-13(5-2)16(14,15)10-7-6-9(3)11(12)8-10/h6-8H,4-5H2,1-3H3
SMILES:CCN(CC)S(=O)(=O)c1ccc(C)c(c1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
