CAS 850429-72-0
:3-Bromo-N,N,4-trimethylbenzenesulfonamide
Description:
3-Bromo-N,N,4-trimethylbenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a substituted aromatic ring. The compound features a bromine atom at the 3-position of the aromatic ring, which is further substituted with three methyl groups at the 1, 4, and 5 positions, contributing to its steric and electronic properties. This structure imparts unique reactivity and solubility characteristics, making it of interest in various chemical applications, including medicinal chemistry and material science. The sulfonamide group is known for its ability to form hydrogen bonds, which can influence the compound's interactions with biological targets. Additionally, the presence of the bromine atom can enhance the compound's reactivity in nucleophilic substitution reactions. Overall, 3-Bromo-N,N,4-trimethylbenzenesulfonamide is a versatile compound with potential applications in drug development and synthesis, owing to its distinctive structural features and functional groups.
Formula:C9H12BrNO2S
InChI:InChI=1S/C9H12BrNO2S/c1-7-4-5-8(6-9(7)10)14(12,13)11(2)3/h4-6H,1-3H3
InChI key:InChIKey=RCPZZSIJSKYSNK-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1=CC(Br)=C(C)C=C1
Synonyms:- 3-Bromo-N,N,4-trimethylbenzenesulfonamide
- 3-Bromo-N,N,4-trimethylbenzene-1-sulfonamide
- Benzenesulfonamide, 3-bromo-N,N,4-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
