CAS 850429-73-1

1-[(3-bromo-4-methylphenyl)sulfonyl]piperidine

Description:

1-[(3-bromo-4-methylphenyl)sulfonyl]piperidine, identified by its CAS number 850429-73-1, is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing heterocycle. The presence of a sulfonyl group (-SO2-) attached to a phenyl ring, specifically a 3-bromo-4-methylphenyl moiety, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, which can influence its solubility in organic solvents. The bromine substituent may impart specific reactivity, making it a potential candidate for further chemical transformations. Additionally, the sulfonyl group can enhance the compound's ability to participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets.

Formula: C₁₂H₁₆BrNO₂S

InChI: InChI=1/C12H16BrNO2S/c1-10-5-6-11(9-12(10)13)17(15,16)14-7-3-2-4-8-14/h5-6,9H,2-4,7-8H2,1H3

SMILES: Cc1ccc(cc1Br)S(=O)(=O)N1CCCCC1

1-(3-BROMO-4-METHYLPHENYLSULFONYL)PIPERIDINE

CAS: 850429-73-1

Formula: C₁₂H₁₆BrNO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 318.2299

Ref: IN-DA003CRX

1-((3-Bromo-4-methylphenyl)sulfonyl)piperidine

CAS: 850429-73-1

1-((3-Bromo-4-methylphenyl)sulfonyl)piperidine

Purity: 98%

Molecular weight: 318.24g/mol

Ref: 54-OR1063984

1-((3-Bromo-4-methylphenyl)sulfonyl)piperidine

CAS: 850429-73-1

Formula: C₁₂H₁₆BrNO₂S

Purity: 95.0%

Molecular weight: 318.23

Ref: 10-F213339