CAS 85046-80-6
:dimethyl acetylphosphoramidate
Description:
Dimethyl acetylphosphoramidate is an organophosphorus compound characterized by its phosphoramidate structure, which includes a phosphorus atom bonded to an acetyl group and two methyl groups. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. Dimethyl acetylphosphoramidate is known for its reactivity, particularly in the context of chemical synthesis and as a potential intermediate in the production of various phosphorus-containing compounds. It can undergo hydrolysis in the presence of water, leading to the formation of phosphoric acid derivatives. Due to its chemical properties, it may pose certain hazards, including toxicity, and should be handled with care in a controlled laboratory environment. Proper safety measures, including the use of personal protective equipment, are essential when working with this substance. Its applications may extend to agricultural chemistry, particularly in the development of pesticides or herbicides, although specific uses can vary based on regulatory approvals and research developments.
Formula:C4H10NO4P
InChI:InChI=1/C4H10NO4P/c1-4(6)5-10(7,8-2)9-3/h1-3H3,(H,5,6,7)
SMILES:CC(=NP(=O)(OC)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
