CAS 85050-11-9

α-2-Propen-1-yl-2-cyclopentene-1-acetic acid

Description:

α-2-Propen-1-yl-2-cyclopentene-1-acetic acid, also known by its CAS number 85050-11-9, is an organic compound characterized by its unique structure that includes a cyclopentene ring and an acetic acid functional group. This compound typically exhibits properties associated with unsaturated carboxylic acids, such as reactivity due to the presence of both double bonds and a carboxylic acid group. It is likely to participate in various chemical reactions, including polymerization and esterification, due to its unsaturation and functional groups. The compound may also display moderate solubility in organic solvents, while its solubility in water could be limited due to the hydrophobic cyclopentene moiety. Additionally, α-2-Propen-1-yl-2-cyclopentene-1-acetic acid may have applications in organic synthesis and as an intermediate in the production of more complex molecules. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₀H₁₄O₂

InChI: InChI=1S/C10H14O2/c1-2-5-9(10(11)12)8-6-3-4-7-8/h2-3,6,8-9H,1,4-5,7H2,(H,11,12)

InChI key: InChIKey=UOSVWXJMXKEOON-UHFFFAOYSA-N

SMILES: C(CC=C)(C(O)=O)C1CCC=C1

Synonyms:

• 2-Cyclopentene-1-acetic acid, α-2-propen-1-yl-
• 2-Cyclopentene-1-acetic acid, α-2-propenyl-
• Δ2-Cyclopenteneacetic acid, α-allyl-
• NSC 63857
• α-2-Propen-1-yl-2-cyclopentene-1-acetic acid