CAS 85056-65-1
:2-(ethoxycarbonyl)-4,6-diphenylpyranium trifluoromethanesulfonate
Description:
2-(Ethoxycarbonyl)-4,6-diphenylpyranium trifluoromethanesulfonate, with the CAS number 85056-65-1, is a chemical compound that belongs to the class of pyranium salts. This substance features a pyranium core, which is a positively charged nitrogen-containing heterocycle, substituted with ethoxycarbonyl and diphenyl groups. The presence of the trifluoromethanesulfonate (triflate) counterion enhances its solubility in polar solvents and contributes to its reactivity. The ethoxycarbonyl group introduces an ester functionality, which can participate in various chemical reactions, including nucleophilic attacks. The diphenyl substituents provide significant steric bulk and electronic effects, influencing the compound's stability and reactivity. This compound is often utilized in organic synthesis, particularly in the formation of complex organic molecules and as a reagent in various chemical transformations. Its unique structural features make it a valuable intermediate in the development of pharmaceuticals and other fine chemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C21H17F3O6S
InChI:InChI=1/C20H17O3.CHF3O3S/c1-2-22-20(21)19-14-17(15-9-5-3-6-10-15)13-18(23-19)16-11-7-4-8-12-16;2-1(3,4)8(5,6)7/h3-14H,2H2,1H3;(H,5,6,7)/q+1;/p-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.