CAS 850567-31-6
:[3-(2-dimethylaminoethylcarbamoyl)phenyl]boronic acid
Description:
[3-(2-Dimethylaminoethylcarbamoyl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a carbamoyl group and a dimethylaminoethyl side chain, contributing to its potential biological activity. The dimethylamino group enhances solubility and may influence the compound's interaction with biological targets. Typically, boronic acids are utilized in medicinal chemistry for their role in drug design, particularly in the development of protease inhibitors and in the synthesis of complex organic molecules through Suzuki coupling reactions. The presence of the boronic acid moiety allows for specific interactions with biomolecules, making it a candidate for applications in targeted therapies. Additionally, the compound's structure suggests potential for modulation of pH-dependent properties, which can be advantageous in various chemical and biological contexts. Overall, [3-(2-dimethylaminoethylcarbamoyl)phenyl]boronic acid represents a versatile scaffold in pharmaceutical research.
Formula:C11H17BN2O3
InChI:InChI=1/C11H17BN2O3/c1-14(2)7-6-13-11(15)9-4-3-5-10(8-9)12(16)17/h3-5,8,16-17H,6-7H2,1-2H3,(H,13,15)
SMILES:CN(C)CCN=C(c1cccc(c1)B(O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-[2-(Dimethylamino)ethylcarbamoyl]benzeneboronic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H17BN2O3Purity:96%Molecular weight:236.083-(2-(Dimethylamino)ethylcarbamoyl)phenylboronic acid
CAS:Formula:C11H17BN2O3Purity:98%Color and Shape:SolidMolecular weight:236.07533-{[2-(Dimethylamino)ethyl]carbamoyl}benzeneboronic acid
CAS:<p>3-{[2-(Dimethylamino)ethyl]carbamoyl}benzeneboronic acid</p>Formula:C11H17BN2O3Purity:98%Color and Shape: white solidMolecular weight:236.08g/mol(3-((2-(Dimethylamino)ethyl)carbamoyl)phenyl)boronic acid
CAS:Formula:C11H17BN2O3Purity:98%Color and Shape:Solid, White to off-white powderMolecular weight:236.083-(2-(Dimethylamino)ethylcarbamoyl)phenylboronic acid
CAS:Controlled ProductFormula:C11H17BN2O3Color and Shape:NeatMolecular weight:236.075




