CymitQuimica logo

CAS 850567-47-4

:

1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole

Description:
1-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole is an organic compound characterized by its unique structure, which includes a pyrrole ring and a boron-containing dioxaborolane moiety. The presence of the pyrrole ring imparts aromatic properties, contributing to its potential reactivity and stability. The dioxaborolane group enhances the compound's utility in various chemical reactions, particularly in organoboron chemistry, where it can serve as a versatile building block for the synthesis of more complex molecules. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (methyl and tetramethyl groups) and polar (boron and oxygen) functional groups. Its solubility may vary depending on the solvent, but it is generally expected to be soluble in organic solvents. Additionally, the presence of the boron atom suggests potential applications in cross-coupling reactions, making it valuable in synthetic organic chemistry. Safety data and handling precautions should be considered, as with all chemical substances, to ensure safe usage in laboratory settings.
Formula:C11H18BNO2
InChI:InChI=1/C11H18BNO2/c1-10(2)11(3,4)15-12(14-10)9-7-6-8-13(9)5/h6-8H,1-5H3
InChI key:OEQQEXKRORJZPR-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cccn2C)O1
Found 4 products.