CymitQuimica logo

CAS 850567-60-1

:

ethyl 2-(1,3,2-dioxaborinan-2-yl)benzoate

Description:
Ethyl 2-(1,3,2-dioxaborinan-2-yl)benzoate is an organic compound characterized by its unique structure, which includes a benzoate moiety and a dioxaborinane ring. This compound typically exhibits properties associated with both esters and boron-containing compounds, making it of interest in various chemical applications, including organic synthesis and materials science. The presence of the dioxaborinane ring suggests potential reactivity in cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Ethyl 2-(1,3,2-dioxaborinan-2-yl)benzoate may also display moderate polarity due to the ester functional group, influencing its solubility in organic solvents. Additionally, the compound's boron content can impart unique properties, such as Lewis acidity, which can be exploited in catalysis. Overall, this compound's characteristics make it a versatile building block in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C12H15BO4
InChI:InChI=1/C12H15BO4/c1-2-15-12(14)10-6-3-4-7-11(10)13-16-8-5-9-17-13/h3-4,6-7H,2,5,8-9H2,1H3
InChI key:WDJJRUITQLOHBH-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccccc1B1OCCCO1
Found 4 products.