CAS 850567-90-7

1,4-dioxaspiro[4.5]dec-8-en-8-ylboronic acid

Description:

1,4-Dioxaspiro[4.5]dec-8-en-8-ylboronic acid is a boronic acid derivative characterized by its unique spirocyclic structure, which incorporates a dioxane moiety and a boronic acid functional group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the dioxaspiro structure contributes to its rigidity and potential for specific molecular interactions. Additionally, the compound may display moderate solubility in polar solvents, and its reactivity can be influenced by the boron atom, which can participate in coordination chemistry. The compound's unique structure and functional groups may also impart specific biological activities, making it of interest in drug development and materials science. Overall, 1,4-dioxaspiro[4.5]dec-8-en-8-ylboronic acid represents a versatile scaffold for further chemical exploration and application.

Formula: C₈H₁₃BO₄

InChI: InChI=1/C8H13BO4/c10-9(11)7-1-3-8(4-2-7)12-5-6-13-8/h1,10-11H,2-6H2

SMILES: C1=C(CCC2(C1)OCCO2)B(O)O

4-Borono-3-cyclohexen-1-one, ethylene glycol ketal

CAS: 850567-90-7

Formula: C₈H₁₃BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.9974

Ref: IN-DA003KUC

1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid

CAS: 850567-90-7

1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid

Purity: 96%

Molecular weight: 184.00g/mol

Ref: 54-OR1927