CAS 850567-96-3

{4-[(methoxycarbonyl)amino]phenyl}boronic acid

Description:

{4-[(Methoxycarbonyl)amino]phenyl}boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a methoxycarbonylamino substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having moderate stability under standard conditions. The boronic acid moiety allows for reversible covalent bonding with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. Its ability to form complexes with biomolecules enhances its potential in drug development and molecular recognition studies. Additionally, the methoxycarbonyl group can influence the compound's reactivity and solubility, providing versatility in chemical reactions. Overall, this compound is significant in the field of organic chemistry, particularly in the development of boron-based reagents and catalysts.

Formula: C₈H₁₀BNO₄

InChI: InChI=1/C8H10BNO4/c1-14-8(11)10-7-4-2-6(3-5-7)9(12)13/h2-5,12-13H,1H3,(H,10,11)

SMILES: COC(=O)Nc1ccc(cc1)B(O)O

4-(Methoxycarbonylamino)benzeneboronic acid, 97%

CAS: 850567-96-3

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₈H₁₀BNO₄

Purity: 97%

Molecular weight: 194.98

Ref: 02-H53027

4-(Methoxycarbonylamino)phenylboronic acid

CAS: 850567-96-3

Formula: C₈H₁₀BNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 194.9803

Ref: IN-DA008GTO

4-(Methoxycarbonylamino)benzeneboronic acid

CAS: 850567-96-3

4-(Methoxycarbonylamino)benzeneboronic acid

Formula: C₈H₁₀BNO₄

Purity: 98%

Color and Shape: beige solid

Molecular weight: 194.98g/mol

Ref: 54-OR10534

(4-((Methoxycarbonyl)amino)phenyl)boronic acid

CAS: 850567-96-3

Purity: 98%

Molecular weight: 194.9799957

Ref: 10-F691550