CAS 850568-00-2
:(4-fluoro-2-hydroxyphenyl)boronic acid
Description:
(4-Fluoro-2-hydroxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenolic structure. This compound features a fluorine atom at the para position relative to the hydroxyl group on the aromatic ring, which can influence its reactivity and solubility. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the hydroxyl group enhances its solubility in polar solvents, while the fluorine substituent can modulate the electronic properties of the molecule, potentially affecting its interactions in biological systems. This compound is often utilized in the development of pharmaceuticals and as a building block in the synthesis of more complex organic molecules. Additionally, its unique properties make it a candidate for applications in materials science and catalysis. Safety and handling precautions should be observed, as with all chemical substances, due to potential reactivity and toxicity.
Formula:C6H6BFO3
InChI:InChI=1/C6H6BFO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9-11H
SMILES:c1cc(c(cc1F)O)B(O)O
Synonyms:- boronic acid, B-(4-fluoro-2-hydroxyphenyl)-
- 4-Fluoro-2-hydroxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Fluoro-2-hydroxyphenylboronic acid
CAS:Formula:C6H6BFO3Purity:97%Color and Shape:SolidMolecular weight:155.91944-Fluoro-2-hydroxybenzeneboronic acid
CAS:4-Fluoro-2-hydroxybenzeneboronic acidFormula:C6H6BFO3Purity:97%Color and Shape: solidMolecular weight:155.92g/molB-(4-Fluoro-2-hydroxyphenyl)-boronic acid
CAS:B-(4-Fluoro-2-hydroxyphenyl)-boronic acid is a fungicide that has been synthesized to inhibit the growth of fungi. This compound is an effective fungicide against a wide variety of plant pathogens. It has been shown to be highly efficient in catalyzing intramolecular cyclization reactions, which are sometimes difficult to perform with traditional methods. The regulatory nature of this compound makes it an excellent candidate for commercial applications in agroscience and industry.Formula:C6H6BFO3Purity:Min. 95%Color and Shape:PowderMolecular weight:155.92 g/mol4-Fluoro-2-hydroxyphenylboronic acid
CAS:Formula:C6H6BFO3Purity:97%Color and Shape:SolidMolecular weight:155.92



