CAS 850568-07-9

Benzoic acid, 2-borono-5-chloro-

Description:

Benzoic acid, 2-borono-5-chloro- (CAS 850568-07-9) is an organic compound characterized by the presence of a benzoic acid moiety substituted with both a boron and a chlorine atom. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The boron atom introduces unique reactivity, making it a potential candidate for applications in organic synthesis and materials science, particularly in the development of boron-containing compounds. The chlorine substituent can influence the compound's reactivity and solubility, affecting its behavior in different solvents and reaction conditions. Overall, this compound's structure suggests potential utility in medicinal chemistry and as a building block in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would need to be referenced from experimental data for precise applications and handling guidelines.

Formula: C₇H₆BClO₄

InChI: InChI=1S/C7H6BClO4/c9-4-1-2-6(8(12)13)5(3-4)7(10)11/h1-3,12-13H,(H,10,11)

InChI key: InChIKey=RENDEFHQQIYNJL-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(C(O)=O)C=C(Cl)C=C1

Synonyms:

• Benzoic acid, 2-borono-5-chloro-
• 2-Borono-5-chlorobenzoicacid
• 2-Borono-5-chlorobenzoic acid

2-Borono-5-chlorobenzoic acid

CAS: 850568-07-9

Formula: C₇H₆BClO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.3841

Ref: IN-DA004SI9

2-Carboxy-4-chlorobenzeneboronic acid

CAS: 850568-07-9

2-Carboxy-4-chlorobenzeneboronic acid

Purity: 98%

Molecular weight: 200.38g/mol

Ref: 54-OR1202

2-Borono-5-chlorobenzoic acid

CAS: 850568-07-9

Formula: C₇H₆BClO₄

Purity: 95%

Molecular weight: 200.38

Ref: 10-F219862