CAS 850568-29-5

[4-(1,2,4-triazol-4-ylcarbamoyl)phenyl]boronic acid hydrochloride

Description:

[4-(1,2,4-triazol-4-ylcarbamoyl)phenyl]boronic acid hydrochloride is a boronic acid derivative characterized by its unique structural features, which include a phenyl ring substituted with a triazole moiety and a carbamoyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the triazole ring contributes to its potential biological activity, as triazoles are known for their role in pharmaceuticals, particularly as antifungal agents. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in aqueous solutions, facilitating its use in biological studies. Additionally, the compound may exhibit specific reactivity patterns due to the boronic acid functionality, allowing for applications in cross-coupling reactions and as a ligand in coordination chemistry. Overall, this compound represents a versatile building block in both synthetic and medicinal chemistry contexts.

Formula: C₉H₁₀BClN₄O₃

InChI: InChI=1/C9H9BN4O3.ClH/c15-9(13-14-5-11-12-6-14)7-1-3-8(4-2-7)10(16)17;/h1-6,16-17H,(H,13,15);1H

SMILES: c1cc(ccc1C(=O)Nn1cnnc1)B(O)O.Cl

(4-((4H-1,2,4-Triazol-4-yl)carbamoyl)phenyl)boronic acid hydrochloride

CAS: 850568-29-5

Formula: C₉H₁₀BClN₄O₃

Color and Shape: Solid

Molecular weight: 268.4647

Ref: IN-DA004PBZ

4-(4H-1,2,4-Triazol-4-ylcarbamoyl)benzeneboronic acid hydrochloride

CAS: 850568-29-5

4-(4H-1,2,4-Triazol-4-ylcarbamoyl)benzeneboronic acid hydrochloride

Purity: 98%

Molecular weight: 268.46g/mol

Ref: 54-OR4100