CAS 850568-41-1
:{4-[(acetylamino)methyl]phenyl}boronic acid
Description:
{4-[(Acetylamino)methyl]phenyl}boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with an acetylamino group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing a moderate melting point. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. Its acetylamino substitution enhances its solubility and may influence its biological activity, potentially serving as a pharmacophore in drug design. Additionally, the compound may participate in Suzuki-Miyaura cross-coupling reactions, which are valuable in organic synthesis for constructing complex molecules. Overall, {4-[(acetylamino)methyl]phenyl}boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C9H12BNO3
InChI:InChI=1/C9H12BNO3/c1-7(12)11-6-8-2-4-9(5-3-8)10(13)14/h2-5,13-14H,6H2,1H3,(H,11,12)
SMILES:CC(=NCc1ccc(cc1)B(O)O)O
Synonyms:- [4-(Acetamidomethyl)phenyl]boronic acid
- boronic acid, B-[4-[(acetylamino)methyl]phenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Acetamidomethyl)benzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H12BNO3Purity:97%Molecular weight:193.01(4-(Acetamidomethyl)phenyl)boronic acid
CAS:Formula:C9H12BNO3Purity:98%Color and Shape:SolidMolecular weight:193.00754-[(Acetylamino)methyl]benzeneboronic acid
CAS:4-[(Acetylamino)methyl]benzeneboronic acidFormula:C9H12BNO3Purity:98%Color and Shape: pale brown solidMolecular weight:193.01g/mol(4-(Acetamidomethyl)phenyl)boronic acid
CAS:Formula:C9H12BNO3Purity:98%Color and Shape:SolidMolecular weight:193.01



