CAS 850568-53-5

B-[3-[(1E)-2-Cyanoethenyl]phenyl]boronic acid

Description:

B-[3-[(1E)-2-Cyanoethenyl]phenyl]boronic acid, identified by its CAS number 850568-53-5, is an organoboron compound characterized by the presence of a boronic acid functional group. This compound features a phenyl ring substituted with a cyanoethenyl group, which contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in various chemical reactions, including Suzuki coupling, which is widely used in the formation of carbon-carbon bonds. The cyano group enhances the electronic properties of the molecule, potentially influencing its reactivity and interactions with biological targets. Additionally, the compound may exhibit interesting photophysical properties due to its conjugated structure, making it a candidate for applications in materials science and organic electronics. Overall, B-[3-[(1E)-2-Cyanoethenyl]phenyl]boronic acid represents a versatile building block in synthetic chemistry, with implications in drug development and advanced material applications.

Formula: C₉H₈BNO₂

InChI: InChI=1S/C9H8BNO2/c11-6-2-4-8-3-1-5-9(7-8)10(12)13/h1-5,7,12-13H/b4-2+

InChI key: InChIKey=YDSLGHLJEJPWNC-DUXPYHPUSA-N

SMILES: C(=C/C#N)\C1=CC(B(O)O)=CC=C1

Synonyms:

• Boronic acid, [3-[(1E)-2-cyanoethenyl]phenyl]-
• Boronic acid, B-[3-[(1E)-2-cyanoethenyl]phenyl]-
• B-[3-[(1E)-2-Cyanoethenyl]phenyl]boronic acid

3-(E-2-Cyanovinyl)phenylboronic acid

CAS: 850568-53-5

Formula: C₉H₈BNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.9763

Ref: IN-DA004Z7L

3-[(E)-2-Cyanovinyl]benzeneboronic acid

CAS: 850568-53-5

3-[(E)-2-Cyanovinyl]benzeneboronic acid

Purity: 95%

Molecular weight: 172.98g/mol

Ref: 54-OR3938

(E)-(3-(2-Cyanovinyl)phenyl)boronic acid

CAS: 850568-53-5

Formula: C₉H₈BNO₂

Purity: ≥97%

Molecular weight: 172.98

Ref: 10-F216149