CAS 850568-54-6
:[4-(tert-butoxycarbonyl)phenyl]boronic acid
Description:
[4-(tert-butoxycarbonyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a tert-butoxycarbonyl (Boc) group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol, while being less soluble in water. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The Boc group serves as a protective group for amines, facilitating the selective functionalization of the phenyl ring. This compound is often utilized in the development of pharmaceuticals and in cross-coupling reactions, such as Suzuki-Miyaura coupling, due to its reactivity and ability to participate in carbon-carbon bond formation. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C11H15BO4
InChI:InChI=1/C11H15BO4/c1-11(2,3)16-10(13)8-4-6-9(7-5-8)12(14)15/h4-7,14-15H,1-3H3
SMILES:CC(C)(C)OC(=O)c1ccc(cc1)B(O)O
Synonyms:- 4-(T-Butoxycarbonyl)phenylboronicacid
- Benzoic Acid, 4-Borono-, 1,1-Dimethylethyl Ester
- 4-(tert-Butoxycarbonyl)phenylboronicacid
- 4-(tert-Butoxycarbonyl)phenylboronic acid
- 4-(Tert-Butoxycarbonyl)Benzeneboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(tert-Butoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C11H15BO4Purity:97.0 to 109.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:222.054-t-Butoxycarbonylphenylboronic acid
CAS:Formula:C11H15BO4Purity:96%Color and Shape:SolidMolecular weight:222.0454Ref: IN-DA0036FY
250gTo inquire500gTo inquire100mg22.00€250mg22.00€1g26.00€5g50.00€10g65.00€25g114.00€100g321.00€4-(tert-Butoxycarbonyl)benzeneboronic acid
CAS:4-(tert-Butoxycarbonyl)benzeneboronic acidFormula:C11H15BO4Purity:98%Color and Shape: white powderMolecular weight:222.05g/mol(4-(tert-Butoxycarbonyl)phenyl)boronic acid
CAS:Formula:C11H15BO4Purity:95%Color and Shape:Solid, Off-white solidMolecular weight:222.05



