CymitQuimica logo

CAS 850568-63-7

:

[2-[(Z)-2-cyanovinyl]phenyl]boronic acid

Description:
[2-[(Z)-2-cyanovinyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a (Z)-2-cyanovinyl group, which introduces a conjugated system that can enhance its reactivity and potential applications in materials science and pharmaceuticals. The boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable for constructing complex organic molecules. Additionally, the presence of the cyano group may impart unique electronic properties, influencing the compound's behavior in various chemical environments. This compound's solubility, stability, and reactivity can be affected by factors such as pH and the presence of other functional groups. Overall, [2-[(Z)-2-cyanovinyl]phenyl]boronic acid exemplifies the versatility of boronic acids in synthetic chemistry and their role in developing new materials and therapeutic agents.
Formula:C9H8BNO2
InChI:InChI=1/C9H8BNO2/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-6,12-13H/b5-3-
SMILES:c1ccc(c(c1)/C=C\C#N)B(O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.