CAS 850568-68-2

[4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenyl]boronic acid

Description:

[4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenyl]boronic acid, with the CAS number 850568-68-2, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and an oxazine ring. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The oxazine moiety contributes to its potential biological activity, as it may interact with biological targets or serve as a scaffold for drug development. The compound is likely to be soluble in polar organic solvents and may exhibit moderate stability under standard laboratory conditions. Its reactivity can be influenced by the presence of functional groups and the overall molecular structure, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its unique structure may provide insights into its potential applications in materials science and catalysis.

Formula: C₁₀H₁₂BNO₃

InChI: InChI=1/C10H12BNO3/c13-11(14)9-4-2-8(3-5-9)10-12-6-1-7-15-10/h2-5,13-14H,1,6-7H2

SMILES: C1CN=C(c2ccc(cc2)B(O)O)OC1

2-(4-Boronophenyl)-5,6-dihydro-4H-1,3-oxazine

CAS: 850568-68-2

Formula: C₁₀H₁₂BNO₃

Color and Shape: Solid

Molecular weight: 205.0182

Ref: IN-DA003BU1