CAS 850568-75-1

4-Hydroxy-3-nitrophenylboronic acid

Description:

4-Hydroxy-3-nitrophenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group, a hydroxyl group, and a nitro group attached to a phenyl ring. This compound typically appears as a solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. The boronic acid moiety allows for reversible covalent bonding with diols, making it useful in various applications, including organic synthesis and as a reagent in chemical biology. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Additionally, the hydroxyl group contributes to its acidity and can participate in hydrogen bonding interactions. Overall, 4-Hydroxy-3-nitrophenylboronic acid is significant in medicinal chemistry and materials science, particularly in the development of sensors and drug delivery systems. Its unique structural features make it a valuable compound for research and industrial applications.

Formula: C₆H₆BNO₅

InChI: InChI=1/C6H6BNO5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9-11H

SMILES: c1cc(c(cc1B(O)O)N(=O)=O)O

Synonyms:

• 4-Hydroxy-3-nitrobenzeneboronic acid

4-hydroxy-3-nitrophenylboronic acid

CAS: 850568-75-1

Formula: C₆H₆BNO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 182.9265

Ref: IN-DA004YHZ

4-Hydroxy-3-nitrobenzeneboronic acid

CAS: 850568-75-1

4-Hydroxy-3-nitrobenzeneboronic acid

Purity: 98%

Molecular weight: 182.93g/mol

Ref: 54-OR1330

(4-Hydroxy-3-nitrophenyl)boronic acid

CAS: 850568-75-1

Formula: C₆H₆BNO₅

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 182.93

Ref: 10-F337975