CAS 850568-80-8

(4-chloro-2-ethoxyphenyl)boronic acid

Description:

(4-Chloro-2-ethoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with a chloro and an ethoxy group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. Its structure contributes to its reactivity, particularly in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is vital for the formation of carbon-carbon bonds. The presence of the chloro and ethoxy substituents can influence its electronic properties and steric hindrance, affecting its reactivity and interaction with other molecules. Overall, (4-chloro-2-ethoxyphenyl)boronic acid serves as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, as well as in materials science.

Formula: C₈H₁₀BClO₃

InChI: InChI=1/C8H10BClO3/c1-2-13-8-5-6(10)3-4-7(8)9(11)12/h3-5,11-12H,2H2,1H3

SMILES: CCOc1cc(ccc1B(O)O)Cl

Synonyms:

• boronic acid, B-(4-chloro-2-ethoxyphenyl)-

4-Chloro-2-ethoxyphenylboronic Acid (contains varying amounts of Anhydride)

CAS: 850568-80-8

Formula: C₈H₁₀BClO₃

Purity: 97.0 to 110.0 %

Color and Shape: White to Almost white powder to crystal

Molecular weight: 200.43

Ref: 3B-C3267

4-Chloro-2-ethoxyphenylboronic acid

CAS: 850568-80-8

Formula: C₈H₁₀BClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.4272

Ref: IN-DA004YHX

4-Chloro-2-ethoxybenzeneboronic acid

CAS: 850568-80-8

4-Chloro-2-ethoxybenzeneboronic acid

Purity: 97%

Molecular weight: 200.43g/mol

Ref: 54-OR13112

4-Chloro-2-ethoxyphenylboronic acid

CAS: 850568-80-8

Formula: C₈H₁₀BClO₃

Purity: 98%

Molecular weight: 200.43

Ref: 10-F219470