CAS 850568-81-9

{3-[(tert-butoxycarbonyl)amino]-4-methylphenyl}boronic acid

Description:

{3-[(tert-butoxycarbonyl)amino]-4-methylphenyl}boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a tert-butoxycarbonyl (Boc) amino group and a methyl group, contributing to its structural complexity and potential reactivity. The Boc group serves as a protecting group for amines, allowing for selective reactions in multi-step syntheses. This compound is likely to exhibit moderate solubility in organic solvents, and its boronic acid moiety may participate in various chemical reactions, including Suzuki coupling, which is valuable in the formation of carbon-carbon bonds. Additionally, the presence of the methyl group may influence the compound's sterics and electronic properties, affecting its reactivity and interactions in biological systems. Overall, this compound is of interest in the fields of organic synthesis and pharmaceutical development.

Formula: C₁₂H₁₈BNO₄

InChI: InChI=1/C12H18BNO4/c1-8-5-6-9(13(16)17)7-10(8)14-11(15)18-12(2,3)4/h5-7,16-17H,1-4H3,(H,14,15)

SMILES: Cc1ccc(cc1N=C(O)OC(C)(C)C)B(O)O

Synonyms:

• carbamic acid, N-(5-borono-2-methylphenyl)-, 1,1-dimethylethyl ester
• {3-[(tert-Butoxycarbonyl)amino]-4-methylphenyl}boronic acid

3-BOC-AMINO-4-METHYLBENZENEBORONIC ACID

CAS: 850568-81-9

Formula: C₁₂H₁₈BNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 251.0866

Ref: IN-DA004YHW

3-Amino-4-methylbenzeneboronic acid, N-BOC protected

CAS: 850568-81-9

3-Amino-4-methylbenzeneboronic acid, N-BOC protected

Purity: 98%

Molecular weight: 251.09g/mol

Ref: 54-OR13113

(3-((tert-Butoxycarbonyl)amino)-4-methylphenyl)boronic acid

CAS: 850568-81-9

Purity: 97%

Molecular weight: 251.0899963

Ref: 10-F618934