
CAS 850570-34-2
:N-Cyclohexyl-2-methoxybenzenamine
Description:
N-Cyclohexyl-2-methoxybenzenamine, identified by its CAS number 850570-34-2, is an organic compound characterized by its amine functional group and aromatic structure. This substance features a cyclohexyl group attached to the nitrogen atom, which contributes to its hydrophobic properties, while the methoxy group (-OCH3) on the benzene ring enhances its solubility in organic solvents. The presence of the amine group indicates that it can participate in hydrogen bonding, influencing its reactivity and interaction with other chemical species. N-Cyclohexyl-2-methoxybenzenamine may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure suggests potential applications in the synthesis of various organic compounds, including dyes, agrochemicals, and pharmaceuticals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-15-13-10-6-5-9-12(13)14-11-7-3-2-4-8-11/h5-6,9-11,14H,2-4,7-8H2,1H3
InChI key:InChIKey=KHDOPTQTRPMFHT-UHFFFAOYSA-N
SMILES:N(C1=C(OC)C=CC=C1)C2CCCCC2
Synonyms:- N-Cyclohexyl-2-methoxyaniline
- N-Cyclohexyl-2-methoxybenzenamine
- Benzenamine, N-cyclohexyl-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.