CAS 850589-32-1

B-[4-[(Butylamino)sulfonyl]phenyl]boronic acid

Description:

B-[4-[(Butylamino)sulfonyl]phenyl]boronic acid, identified by its CAS number 850589-32-1, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a butylamino and sulfonyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the sulfonamide moiety. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. The butylamino group enhances its solubility and may influence its biological activity, while the sulfonyl group can contribute to its reactivity and stability. Overall, this compound is of interest in the development of pharmaceuticals and as a reagent in chemical reactions, particularly in the context of drug discovery and material science.

Formula: C₁₀H₁₆BNO₄S

InChI: InChI=1S/C10H16BNO4S/c1-2-3-8-12-17(15,16)10-6-4-9(5-7-10)11(13)14/h4-7,12-14H,2-3,8H2,1H3

InChI key: InChIKey=BEBIGVQNUYZEPK-UHFFFAOYSA-N

SMILES: S(NCCCC)(=O)(=O)C1=CC=C(B(O)O)C=C1

Synonyms:

• Boronic acid, [4-[(butylamino)sulfonyl]phenyl]-
• Boronic acid, B-[4-[(butylamino)sulfonyl]phenyl]-
• 4-(n-Butylsulfamoyl)phenylboronic acid
• B-[4-[(Butylamino)sulfonyl]phenyl]boronic acid

N-Butyl 4-boronobenzenesulfonamide

CAS: 850589-32-1

Formula: C₁₀H₁₆BNO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 257.1143

Ref: IN-DA004S9J

4-(N-Butylsulphonamido)benzeneboronic acid

CAS: 850589-32-1

4-(N-Butylsulphonamido)benzeneboronic acid

Purity: 97%

Molecular weight: 257.11g/mol

Ref: 54-OR4130

(4-(n-Butylsulfamoyl)phenyl)boronic acid

CAS: 850589-32-1

Purity: 95%

Molecular weight: 257.1099854

Ref: 10-F692507