CymitQuimica logo

CAS 850589-39-8

:

[3-chloro-4-(methylcarbamoyl)phenyl]boronic acid

Description:
[3-chloro-4-(methylcarbamoyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a chlorine atom and a methylcarbamoyl group, which contributes to its reactivity and potential biological activity. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the methylcarbamoyl group may impart specific pharmacological properties, enhancing its utility in drug development. This compound is typically solid at room temperature and may exhibit solubility in polar solvents. Its unique structure and functional groups suggest potential applications in various fields, including pharmaceuticals and materials science, particularly in the development of targeted therapies and advanced materials. Safety and handling precautions should be observed due to the potential reactivity of boronic acids.
Formula:C8H9BClNO3
InChI:InChI=1/C8H9BClNO3/c1-11-8(12)6-3-2-5(9(13)14)4-7(6)10/h2-4,13-14H,1H3,(H,11,12)
InChI key:UDPDTEGKPHZNES-UHFFFAOYSA-N
SMILES:CN=C(c1ccc(cc1Cl)B(O)O)O
Synonyms:
  • (3-Chloro-4-(methylcarbamoyl)phenyl)boronicacid
Found 4 products.