CymitQuimica logo

CAS 850589-47-8

:

B-[3-Chloro-4-[(dimethylamino)carbonyl]phenyl]boronic acid

Description:
B-[3-Chloro-4-[(dimethylamino)carbonyl]phenyl]boronic acid is a boronic acid derivative characterized by its unique functional groups, which include a boron atom bonded to a phenyl ring that carries a chloro substituent and a dimethylaminocarbonyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the chloro group can influence its reactivity and solubility, while the dimethylaminocarbonyl moiety may enhance its biological activity or interaction with specific targets. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. Overall, this compound's structure suggests potential utility in drug development and materials science, particularly in the design of compounds that interact with biological systems or serve as intermediates in synthetic pathways.
Formula:C9H11BClNO3
InChI:InChI=1S/C9H11BClNO3/c1-12(2)9(13)7-4-3-6(10(14)15)5-8(7)11/h3-5,14-15H,1-2H3
InChI key:InChIKey=FRYXYHGYFIBOQR-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=C(Cl)C=C(B(O)O)C=C1
Synonyms:
  • Boronic acid, [3-chloro-4-[(dimethylamino)carbonyl]phenyl]-
  • Boronic acid, B-[3-chloro-4-[(dimethylamino)carbonyl]phenyl]-
  • (3-Chloro-4-(dimethylaminocarbonyl)phenyl)boronic acid
  • [3-Chloro-4-(dimethylcarbamoylcarbonyl)phenyl]boronic acid
  • B-[3-Chloro-4-[(dimethylamino)carbonyl]phenyl]boronic acid
Found 4 products.