CymitQuimica logo

CAS 850589-52-5

:

B-[4-(Aminocarbonyl)-3-chlorophenyl]boronic acid

Description:
B-[4-(Aminocarbonyl)-3-chlorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound features a chlorophenyl moiety substituted with an aminocarbonyl group, contributing to its potential biological activity. The presence of the boronic acid group allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the aminocarbonyl group may enhance its solubility and reactivity, while the chlorine atom can influence its electronic properties and reactivity. This compound is typically used in research settings, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to interact with biological targets. As with many boronic acids, it is important to handle this substance with care, considering its reactivity and potential environmental impact.
Formula:C7H7BClNO3
InChI:InChI=1S/C7H7BClNO3/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H2,10,11)
InChI key:InChIKey=ZARZNNIZDSRQFA-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(Cl)=C(C(N)=O)C=C1
Synonyms:
  • Boronic acid, B-[4-(aminocarbonyl)-3-chlorophenyl]-
  • [3-Chloro-4-carbamoylphenyl]boronic acid
  • Boronic acid, [4-(aminocarbonyl)-3-chlorophenyl]-
  • B-[4-(Aminocarbonyl)-3-chlorophenyl]boronic acid
  • (4-(Aminocarbonyl)-3-chlorophenyl)boronic acid
Found 4 products.