CAS 850593-10-1

[2-ethoxy-5-(trifluoromethyl)phenyl]boronic acid

Description:

[2-Ethoxy-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with an ethoxy group and a trifluoromethyl group, which can influence its electronic properties and reactivity. The trifluoromethyl group is known for imparting lipophilicity and can enhance the compound's biological activity. The boronic acid moiety allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of the ethoxy group can affect solubility and stability in different solvents. Overall, [2-ethoxy-5-(trifluoromethyl)phenyl]boronic acid is a versatile compound with significant implications in synthetic chemistry and potential applications in pharmaceuticals.

Formula: C₉H₁₀BF₃O₃

InChI: InChI=1/C9H10BF3O3/c1-2-16-8-4-3-6(9(11,12)13)5-7(8)10(14)15/h3-5,14-15H,2H2,1H3

SMILES: CCOc1ccc(cc1B(O)O)C(F)(F)F

Synonyms:

• boronic acid, B-[2-ethoxy-5-(trifluoromethyl)phenyl]-
• 2-Ethoxy-5-(Trifluoromethoxy)Phenylboronicacid
• 2-Ethoxy-5-(Trifluoromethoxy)Phenylboronic Acid
• 2-Ethoxy-5-Trifluoromethylphenylboronic Acid

2-Ethoxy-5-trifluoromethylphenylboronic acid

CAS: 850593-10-1

Formula: C₉H₁₀BF₃O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 233.9801

Ref: IN-DA004S9F

2-Ethoxy-5-(trifluoromethyl)benzeneboronic acid

CAS: 850593-10-1

2-Ethoxy-5-(trifluoromethyl)benzeneboronic acid

Purity: 98%

Molecular weight: 233.98g/mol

Ref: 54-PC1619

2-Ethoxy-5-trifluoromethylphenylboronic acid

CAS: 850593-10-1

Formula: C₉H₁₀BF₃O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 233.98

Ref: 10-F219448