CAS 850623-40-4

Borate(1-), trifluoro[4-(methylsulfonyl)phenyl]-, potassium (1:1), (T-4)-

Description:

Borate(1-), trifluoro[4-(methylsulfonyl)phenyl]-, potassium (1:1), commonly referred to by its CAS number 850623-40-4, is a chemical compound characterized by its borate anion and a trifluoromethyl-substituted phenyl group. This compound features a potassium cation, which balances the negative charge of the borate anion. The presence of the methylsulfonyl group enhances its solubility and reactivity, making it useful in various chemical applications. The trifluoromethyl group contributes to the compound's unique electronic properties, potentially influencing its behavior in chemical reactions. Typically, borate compounds are known for their applications in materials science, agriculture, and as intermediates in organic synthesis. The specific structure of this compound suggests potential utility in specialized applications, including pharmaceuticals or agrochemicals, due to the functional groups present. As with many borate compounds, it may exhibit interesting properties such as coordination chemistry and catalytic activity, depending on the surrounding environment and conditions.

Formula: C₇H₇BF₃O₂S·K

InChI: InChI=1S/C7H7BF3O2S.K/c1-14(12,13)7-4-2-6(3-5-7)8(9,10)11;/h2-5H,1H3;/q-1;+1

InChI key: InChIKey=QOZWCMTYKAZMHD-UHFFFAOYSA-N

SMILES: [B+3]([F-])([F-])([F-])[C-]=1C=CC(S(C)(=O)=O)=CC1.[K+]

Synonyms:

• Borate(1-), trifluoro[4-(methylsulfonyl)phenyl]-, potassium (1:1), (T-4)-

Potassium (4-methylsulfonylphenyl)trifluoroborate

CAS: 850623-40-4

Formula: C₇H₇BF₃KO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 262.0988

Ref: IN-DA008GP1

Potassium (4-methylsulphonylphenyl)trifluoroborate

CAS: 850623-40-4

Potassium (4-methylsulphonylphenyl)trifluoroborate

Purity: 98%

Molecular weight: 262.10g/mol

Ref: 54-PC11244

Potassium trifluoro(4-(methylsulfonyl)phenyl)borate

CAS: 850623-40-4

Purity: 98%

Molecular weight: 262.09

Ref: 10-F986548