CAS 85064-61-5

Tetrahydropyran-4-yl-acetic acid

Description:

Tetrahydropyran-4-yl-acetic acid is an organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether containing one oxygen atom. This compound features an acetic acid functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of both the tetrahydropyran moiety and the carboxylic acid group allows for various chemical reactions, including esterification and amidation, making it useful in the synthesis of pharmaceuticals and agrochemicals. Its solubility in polar solvents like water and alcohols enhances its utility in various chemical processes. Additionally, the compound's stability under standard conditions and its relatively low toxicity make it a candidate for further research in medicinal chemistry and material science. As with any chemical substance, proper handling and safety precautions should be observed to mitigate any potential hazards associated with its use.

Formula: C₇H₁₁O₃

InChI: InChI=1/C7H12O3/c8-7(9)5-6-1-3-10-4-2-6/h6H,1-5H2,(H,8,9)/p-1

SMILES: C1COCCC1CC(=O)[O-]

Synonyms:

• 2H-Pyran-4-acetic acid, tetrahydro-
• Tetrahydro-2H-pyran-4-ylacetic acid
• Tetrahydropyranyl-4-aceticacid
• tetrahydro-2H-pyran-4-ylacetate
• Tetrahydropyranyl-4-acetic acid
• (Tetrahydro-Pyran-4-Yl)-Acetic Acid
• 2-(Oxan-4-Yl)Acetic Acid

Tetrahydropyranyl-4-acetic acid

CAS: 85064-61-5

Formula: C₇H₁₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 144.17

Ref: 10-F011896

Tetrahydropyran-4-yl-acetic acid

CAS: 85064-61-5

Formula: C₇H₁₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 144.1684

Ref: IN-DA0036EC

Tetrahydro-2H-pyran-4-ylacetic acid

CAS: 85064-61-5

Tetrahydro-2H-pyran-4-ylacetic acid

Formula: C₇H₁₂O₃

Purity: 97%

Color and Shape: white solid

Molecular weight: 144.17g/mol

Ref: 54-OR10586