CymitQuimica logo

CAS 85068-38-8

:

4-(1-Aminopropyl)phenol

Description:
4-(1-Aminopropyl)phenol, also known as 4-(aminopropyl)phenol or by its CAS number 85068-38-8, is an organic compound characterized by the presence of a phenolic group and an aminoalkyl side chain. This substance typically appears as a solid or crystalline material and is soluble in polar solvents due to its hydroxyl and amino functional groups. The compound exhibits basic properties due to the amino group, which can participate in hydrogen bonding and may influence its reactivity and interactions with other molecules. It is often studied for its potential applications in pharmaceuticals, particularly in the development of compounds with neuroprotective or antidepressant properties. Additionally, the presence of both the amine and phenolic functionalities allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-2-9(10)7-3-5-8(11)6-4-7/h3-6,9,11H,2,10H2,1H3
InChI key:InChIKey=WTQZYHPAVNTISM-UHFFFAOYSA-N
SMILES:C(CC)(N)C1=CC=C(O)C=C1
Synonyms:
  • Phenol, 4-(1-aminopropyl)-
  • 1-Amino-1-(4-hydroxyphenyl)propane
  • 4-(1-Aminopropyl)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.