
CAS 85068-51-5
:20-Hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl 10-undecenoate
Description:
20-Hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl 10-undecenoate, with the CAS number 85068-51-5, is a synthetic compound characterized by its complex structure, which includes a long hydrocarbon chain and multiple ether linkages due to the presence of six oxo groups. This compound is likely to exhibit amphiphilic properties, making it soluble in both polar and non-polar solvents, which is typical for molecules with long alkyl chains and polar functional groups. Its structure suggests potential applications in fields such as drug delivery, emulsification, or as a surfactant due to its ability to interact with both hydrophilic and hydrophobic environments. Additionally, the presence of the undecenoate moiety indicates that it may participate in various chemical reactions, including polymerization or cross-linking, under appropriate conditions. The stability, reactivity, and specific applications of this compound would depend on its environmental conditions and the presence of other reactants. Further studies would be necessary to fully elucidate its properties and potential uses in industrial or pharmaceutical applications.
Formula:C25H48O9
InChI:InChI=1S/C25H48O9/c1-2-3-4-5-6-7-8-9-10-25(27)34-24-23-33-22-21-32-20-19-31-18-17-30-16-15-29-14-13-28-12-11-26/h2,26H,1,3-24H2
InChI key:InChIKey=FSUNBVHKEPRZEA-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCCC=C)=O)CCOCCOCCOCCOCCOCCOCCO
Synonyms:- 10-Undecenoic acid, 20-hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl ester
- 20-Hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl 10-undecenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
20-HYDROXY-3,6,9,12,15,18-HEXAOXAICOS-1-YL UNDEC-10-ENOATE
CAS:Formula:C25H48O9Molecular weight:492.6432
