CymitQuimica logo

CAS 85068-52-6

:

10-Undecenoic acid, 3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl ester

Description:
10-Undecenoic acid, 3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl ester, identified by CAS number 85068-52-6, is a synthetic compound characterized by its long-chain fatty acid structure combined with a polyether segment. This compound features a terminal undecenoic acid moiety, which contributes to its amphiphilic properties, making it soluble in both polar and non-polar solvents. The presence of multiple ether linkages in the polyether chain enhances its thermal stability and flexibility, while also imparting low surface tension characteristics. This ester is often utilized in various applications, including as a surfactant, emulsifier, or in the formulation of specialty chemicals. Its unique structure allows for potential use in drug delivery systems and as a component in advanced materials. Additionally, the compound's properties can be influenced by the length of the hydrocarbon chain and the degree of unsaturation, which can affect its physical and chemical behavior in different environments. Overall, this compound exemplifies the versatility of ester derivatives in chemical applications.
Formula:C36H66O10
InChI:InChI=1S/C36H66O10/c1-3-5-7-9-11-13-15-17-19-35(37)45-33-31-43-29-27-41-25-23-39-21-22-40-24-26-42-28-30-44-32-34-46-36(38)20-18-16-14-12-10-8-6-4-2/h3-4H,1-2,5-34H2
InChI key:InChIKey=IFTBBSBRIXUVBU-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOCCOCCOC(CCCCCCCCC=C)=O)(CCCCCCCCC=C)=O
Synonyms:
  • 10-Undecenoic acid, 3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.