CAS 850689-32-6

B-[2-(Aminomethyl)-5-fluorophenyl]boronic acid

Description:

B-[2-(Aminomethyl)-5-fluorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound features a fluorinated phenyl ring, which can enhance its biological activity and influence its electronic properties. The aminomethyl group contributes to its solubility and reactivity, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Additionally, this compound may exhibit unique interactions with biological targets, potentially leading to applications in drug development. Its stability, solubility, and reactivity profile make it a significant compound in both research and industrial applications. As with many boronic acids, care must be taken in handling and storage due to their sensitivity to moisture and air.

Formula: C₇H₉BFNO₂

InChI: InChI=1S/C7H9BFNO2/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-3,11-12H,4,10H2

InChI key: InChIKey=BZJLAAIEOZMRNR-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(CN)C=CC(F)=C1

Synonyms:

• 2-Aminomethyl-5-fluorophenylboronic acid
• B-[2-(Aminomethyl)-5-fluorophenyl]boronic acid
• Boronic acid, B-[2-(aminomethyl)-5-fluorophenyl]-
• Boronic acid, [2-(aminomethyl)-5-fluorophenyl]-

Boronic acid, B-[2-(aminomethyl)-5-fluorophenyl]-

CAS: 850689-32-6

Formula: C₇H₉BFNO₂

Molecular weight: 168.9613

Ref: IN-DA00KHW3