CAS 85070-47-9
:3-Chloro-2-fluorobenzyl bromide
Description:
3-Chloro-2-fluorobenzyl bromide is an organic compound characterized by its aromatic structure, which includes a benzyl group substituted with both chlorine and fluorine atoms. The presence of these halogens introduces unique reactivity and properties to the molecule. Typically, this compound appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential use in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitution reactions. The chlorine and fluorine substituents can influence the compound's polarity, boiling point, and solubility in various solvents. Additionally, safety precautions are necessary when handling this substance, as it may pose health risks through inhalation or skin contact. Proper storage conditions should be maintained to prevent degradation or unwanted reactions. Overall, 3-Chloro-2-fluorobenzyl bromide is a valuable intermediate in chemical synthesis, with applications in various fields of chemistry.
Formula:C7H5BrClF
InChI:InChI=1/C7H5BrClF/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2
SMILES:c1cc(CBr)c(c(c1)Cl)F
Synonyms:- 1-(Bromomethyl)-3-Chloro-2-Fluorobenzene
- 2-Fluoro-3-chlorobenzyl bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Chloro-2-fluorobenzyl Bromide
CAS:Formula:C7H5BrClFPurity:>96.0%(GC)(T)Color and Shape:White or Colorless to Light yellow to Light orange powder to lump to clear liquidMolecular weight:223.471-(Bromomethyl)-3-chloro-2-fluorobenzene
CAS:Formula:C7H5BrClFPurity:96%Color and Shape:SolidMolecular weight:223.47003-Chloro-2-fluorobenzyl bromide
CAS:3-Chloro-2-fluorobenzyl bromideFormula:C7H5BrClFPurity:97%Color and Shape: colourless to off white crystalsMolecular weight:223.47g/mol3-Chloro-2-fluorobenzyl bromide
CAS:Formula:C7H5BrClFPurity:96%Color and Shape:Low Melting SolidMolecular weight:223.473-Chloro-2-fluorobenzyl Bromide
CAS:Controlled ProductApplications 3-Chloro-2-fluorobenzyl Bromide (cas# 85070-47-9) is a compound useful in organic synthesis.
Formula:C7H5BrClFColor and Shape:NeatMolecular weight:223.47





