CymitQuimica logo

CAS 850713-84-7

:

2-Fluoro-5-(4-pyridinyl)benzenamine

Description:
2-Fluoro-5-(4-pyridinyl)benzenamine, with the CAS number 850713-84-7, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a pyridine ring. This compound features a fluorobenzene moiety substituted at the 2-position with a fluorine atom and at the 5-position with a 4-pyridinyl group, contributing to its unique chemical properties. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications, such as in pharmaceuticals or agrochemicals. The fluorine atom can enhance the compound's lipophilicity and metabolic stability, which are important factors in drug design. Additionally, the pyridine ring may impart specific electronic properties, influencing the compound's reactivity and interaction with biological targets. Overall, 2-Fluoro-5-(4-pyridinyl)benzenamine is a compound of interest in medicinal chemistry due to its structural features and potential biological activity.
Formula:C11H9FN2
InChI:InChI=1S/C11H9FN2/c12-10-2-1-9(7-11(10)13)8-3-5-14-6-4-8/h1-7H,13H2
InChI key:InChIKey=PZBMPYSBIYOWLP-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1F)C=2C=CN=CC2
Synonyms:
  • 2-Fluoro-5-(4-pyridinyl)benzenamine
  • 2-Fluoro-5-(pyridin-4-yl)aniline
  • Benzenamine, 2-fluoro-5-(4-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.