CAS 850734-85-9

Thieno[2,3-c]pyridine, 7-(1-piperazinyl)-, hydrochloride (1:1)

Description:

Thieno[2,3-c]pyridine, 7-(1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both thieno and pyridine rings. This compound features a piperazine moiety, which is known for its pharmacological properties, often enhancing the compound's bioactivity. The hydrochloride salt form indicates that the compound is protonated, which typically improves its solubility in water and biological fluids, making it more suitable for pharmaceutical applications. The presence of the thieno and pyridine rings suggests potential interactions with various biological targets, possibly influencing neurotransmitter systems or other cellular pathways. This compound may be of interest in medicinal chemistry for its potential therapeutic effects, particularly in the fields of neuropharmacology or as an antipsychotic agent. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. As with many compounds in drug development, further studies would be necessary to fully elucidate its biological activity and safety profile.

Formula: C₁₁H₁₃N₃S·ClH

InChI: InChI=1S/C11H13N3S.ClH/c1-3-13-11(10-9(1)2-8-15-10)14-6-4-12-5-7-14;/h1-3,8,12H,4-7H2;1H

InChI key: InChIKey=LMFIHEMWGLYVFO-UHFFFAOYSA-N

SMILES: C12=C(N=CC=C1C=CS2)N3CCNCC3.Cl

Synonyms:

• 7-(Piperazin-1-Yl)Thieno[2,3-C]Pyridine Hydrochloride (1:1)
• Thieno[2,3-c]pyridine, 7-(1-piperazinyl)-, hydrochloride (1:1)
• Thieno[2,3-c]pyridine, 7-(1-piperazinyl)-, monohydrochloride