CAS 85076-06-8
:Axamozide
Description:
Axamozide, with the CAS number 85076-06-8, is a chemical compound that belongs to the class of monoamine oxidase inhibitors (MAOIs). It is primarily recognized for its potential use in the treatment of various psychiatric disorders, particularly depression. The substance exhibits a mechanism of action that involves the inhibition of the monoamine oxidase enzyme, which is responsible for the breakdown of neurotransmitters such as serotonin, norepinephrine, and dopamine in the brain. By inhibiting this enzyme, Axamozide can increase the levels of these neurotransmitters, potentially leading to improved mood and emotional stability. The compound is characterized by its specific chemical structure, which contributes to its pharmacological properties. However, like other MAOIs, Axamozide may have dietary restrictions and interactions with certain medications, necessitating careful management in clinical settings. Its safety profile, efficacy, and side effects are subjects of ongoing research, and it is essential for healthcare providers to consider these factors when prescribing this medication.
Formula:C21H22ClN3O3
InChI:InChI=1/C21H22ClN3O3/c22-14-5-6-18-17(11-14)23-21(26)25(18)15-7-9-24(10-8-15)12-16-13-27-19-3-1-2-4-20(19)28-16/h1-6,11,15-16H,7-10,12-13H2,(H,23,26)
Synonyms:- UNII-MCG9O55T6K
- ( -)-1-(1-(1,4-benzodioxan-2-ylmethyl)-4-piperidyl)-5-chlor-2-benzimidazolinon
- 5-chloro-1-[1-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)piperidin-4-yl]-1,3-dihydro-2H-benzimidazol-2-one
- ( -)-1-(1-(1,4-benzodioxan-2-ylmethyl)-4-piperidyl)-5-chloro-2-benzimidazolinone
- Axamozide [INN]
- (+-)-1-(1-(1,4-Benzodioxan-2-ylmethyl)-4-piperidyl)-5-chloro-2-benzimidazolinone
- Axamozidum
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Axamozide
CAS:Axamozide is a biochemical.Formula:C21H22ClN3O3Color and Shape:SolidMolecular weight:399.87
