CymitQuimica logo

CAS 850797-92-1

:

Morpholine, 4-[2-[4-nitro-2-(trifluoromethyl)phenoxy]ethyl]-

Description:
Morpholine, 4-[2-[4-nitro-2-(trifluoromethyl)phenoxy]-] is a chemical compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. This compound features a nitro group and a trifluoromethyl group attached to a phenoxyethyl side chain, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, while the nitro group may participate in various chemical reactions, including reduction and nucleophilic substitution. Morpholine derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their ability to interact with biological systems and their structural versatility. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C13H15F3N2O4
InChI:InChI=1S/C13H15F3N2O4/c14-13(15,16)11-9-10(18(19)20)1-2-12(11)22-8-5-17-3-6-21-7-4-17/h1-2,9H,3-8H2
InChI key:PDOWEJZBJZMEDA-UHFFFAOYSA-N
SMILES:C1COCCN1CCOC2=C(C=C(C=C2)[N+](=O)[O-])C(F)(F)F
Found 1 products.