CymitQuimica logo

CAS 850852-86-7

:

4-(1,3-Benzodioxol-5-yl)-5-methyl-2-thiazolamine

Description:
4-(1,3-Benzodioxol-5-yl)-5-methyl-2-thiazolamine, with the CAS number 850852-86-7, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a benzodioxole moiety. The thiazole ring contributes to its potential biological activity, often associated with compounds that exhibit antimicrobial or anticancer properties. The presence of the benzodioxole group may enhance its lipophilicity and influence its interaction with biological targets. This compound is typically synthesized through organic reactions that involve the formation of the thiazole ring and subsequent functionalization to introduce the benzodioxole substituent. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, its reactivity may be influenced by the presence of functional groups, making it a candidate for further chemical modifications. Research into its pharmacological properties is essential to fully understand its potential applications in medicinal chemistry and drug development.
Formula:C11H10N2O2S
InChI:InChI=1S/C11H10N2O2S/c1-6-10(13-11(12)16-6)7-2-3-8-9(4-7)15-5-14-8/h2-4H,5H2,1H3,(H2,12,13)
InChI key:InChIKey=OYDIWYBKYNFSAJ-UHFFFAOYSA-N
SMILES:CC1=C(C=2C=C3C(=CC2)OCO3)N=C(N)S1
Synonyms:
  • 4-(1,3-Benzodioxol-5-yl)-5-methyl-2-thiazolamine
  • 2-Thiazolamine, 4-(1,3-benzodioxol-5-yl)-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.