CAS 850869-67-9

1H-Pyrazol-3-amine, 5-(1-naphthalenyl)-, hydrochloride (1:1)

Description:

1H-Pyrazol-3-amine, 5-(1-naphthalenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole and naphthalene moieties, which contribute to its unique properties. The presence of the pyrazole ring provides potential for various biological activities, including anti-inflammatory and analgesic effects. The hydrochloride form indicates that the compound is a salt, which often enhances its solubility in water and stability. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of novel therapeutic agents. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, which can be exploited in further chemical modifications or in the development of derivatives. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 1H-Pyrazol-3-amine, 5-(1-naphthalenyl)-, hydrochloride (1:1) represents a valuable compound in the field of organic and medicinal chemistry.

Formula: C₁₃H₁₁N₃·ClH

InChI: InChI=1S/C13H11N3.ClH/c14-13-8-12(15-16-13)11-7-3-5-9-4-1-2-6-10(9)11;/h1-8H,(H3,14,15,16);1H

InChI key: InChIKey=PQSGMQLQAIHSES-UHFFFAOYSA-N

SMILES: NC=1C=C(C=2C3=C(C=CC2)C=CC=C3)NN1.Cl

Synonyms:

• 1H-Pyrazol-3-amine, 5-(1-naphthalenyl)-, monohydrochloride
• 1H-Pyrazol-3-amine, 5-(1-naphthalenyl)-, hydrochloride (1:1)
• 3-(1-Naphthyl)-1H-pyrazol-5-ylamine hydrochloride