
CAS 850876-28-7
:2,3-Dihydro-N-(1-methylethyl)-1H-isoindol-5-amine
Description:
2,3-Dihydro-N-(1-methylethyl)-1H-isoindol-5-amine, identified by its CAS number 850876-28-7, is a chemical compound that belongs to the class of isoindoles, which are bicyclic compounds featuring a fused benzene and pyrrole ring. This substance typically exhibits characteristics such as a moderate molecular weight and specific structural features that contribute to its reactivity and potential biological activity. The presence of an amine functional group suggests that it may engage in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the isopropyl group attached to the nitrogen atom can affect the compound's steric properties and lipophilicity, potentially impacting its pharmacokinetic profile. While specific applications may vary, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Overall, the unique structural attributes of 2,3-Dihydro-N-(1-methylethyl)-1H-isoindol-5-amine make it a subject of interest in various chemical and biological research fields.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-8(2)13-11-4-3-9-6-12-7-10(9)5-11/h3-5,8,12-13H,6-7H2,1-2H3
InChI key:InChIKey=UIEHHQOIYDRUJF-UHFFFAOYSA-N
SMILES:N(C(C)C)C=1C=C2C(=CC1)CNC2
Synonyms:- 2,3-Dihydro-N-(1-methylethyl)-1H-isoindol-5-amine
- 1H-Isoindol-5-amine, 2,3-dihydro-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.