CAS 850892-12-5

5-bromo-4-methylpyridin-3-amine

Description:

5-Bromo-4-methylpyridin-3-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 4-position, along with an amino group at the 3-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It is often used in medicinal chemistry and research applications, particularly in the synthesis of pharmaceuticals and agrochemicals. The bromine substituent can also serve as a useful handle for further chemical modifications. As with many nitrogen-containing heterocycles, it may display basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₇BrN₂

InChI: InChI=1/C6H7BrN2/c1-4-5(7)2-9-3-6(4)8/h2-3H,8H2,1H3

SMILES: Cc1c(cncc1N)Br

Synonyms:

• 3-Pyridinamine, 5-Bromo-4-Methyl-
• 3-AMino-5-bromo-4-Methylpyridine

5-Bromo-4-methylpyridin-3-amine

CAS: 850892-12-5

Formula: C₆H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 187.0372

Ref: IN-DA008GO3

5-Bromo-4-methyl-3-aminopyridine

CAS: 850892-12-5

5-Bromo-4-methyl-3-aminopyridine

Purity: 99%

Molecular weight: 187.03717g/mol

Ref: 54-OR301208

5-Bromo-4-methylpyridin-3-amine

CAS: 850892-12-5

Formula: C₆H₇BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 187.04

Ref: 10-F230840