CymitQuimica logo

CAS 850892-14-7

:

1-(Tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-3-carboxaldehyde

Description:
1-(Tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-3-carboxaldehyde, with the CAS number 850892-14-7, is a complex organic compound characterized by its unique structural features. It contains an indazole core, which is a bicyclic structure known for its biological activity, particularly in medicinal chemistry. The presence of a carboxaldehyde functional group indicates potential reactivity, allowing for further chemical modifications or interactions. The tetrahydro-2H-pyran moiety contributes to the compound's overall stability and solubility in organic solvents. Additionally, the inclusion of a dioxaborolane group suggests potential applications in boron chemistry, such as in cross-coupling reactions or as a boron source in various synthetic pathways. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its synthesis and characterization would typically involve advanced organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its structure and purity.
Formula:C19H25BN2O4
InChI:InChI=1S/C19H25BN2O4/c1-18(2)19(3,4)26-20(25-18)13-8-9-16-14(11-13)15(12-23)21-22(16)17-7-5-6-10-24-17/h8-9,11-12,17H,5-7,10H2,1-4H3
InChI key:InChIKey=DTMUGJQIZZUQCF-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(N(N1)C3CCCCO3)=CC=C(C2)B4OC(C)(C)C(C)(C)O4
Synonyms:
  • 1-(Tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-3-carboxaldehyde
  • 1H-Indazole-3-carboxaldehyde, 1-(tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.