
CAS 850895-66-8
:2-[2-(Methylsulfonyl)phenoxy]ethanamine
Description:
2-[2-(Methylsulfonyl)phenoxy]ethanamine, identified by its CAS number 850895-66-8, is an organic compound characterized by its unique functional groups. It features an ethanamine backbone, which is an amine with an ethyl chain, and a phenoxy group substituted with a methylsulfonyl moiety. This structure imparts both hydrophilic and lipophilic properties, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the methylsulfonyl group enhances its solubility in polar solvents and may contribute to its biological activity. The compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the surrounding environment and conditions. Its synthesis typically involves the reaction of appropriate precursors, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, 2-[2-(Methylsulfonyl)phenoxy]ethanamine represents a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C9H13NO3S
InChI:InChI=1S/C9H13NO3S/c1-14(11,12)9-5-3-2-4-8(9)13-7-6-10/h2-5H,6-7,10H2,1H3
InChI key:InChIKey=GWKGJQRAJPOIAW-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(OCCN)C=CC=C1
Synonyms:- 2-(2-Methylsulfonylphenoxy)ethylamine
- Ethanamine, 2-[2-(methylsulfonyl)phenoxy]-
- 2-[2-(Methylsulfonyl)phenoxy]ethanamine
- 2-(2-Methanesulfonylphenoxy)ethan-1-amine
- 1-(2-Aminoethoxy)-2-methanesulfonylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.