
CAS 85092-86-0
:3-Iodo-5-methoxy-1H-indole
Description:
3-Iodo-5-methoxy-1H-indole is a chemical compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features an iodine atom at the 3-position and a methoxy group (-OCH3) at the 5-position of the indole ring, which influences its reactivity and solubility. The presence of the iodine atom can enhance the compound's electrophilic properties, making it useful in various synthetic applications, including medicinal chemistry and organic synthesis. The methoxy group contributes to the compound's overall polarity and can affect its biological activity. 3-Iodo-5-methoxy-1H-indole may exhibit interesting pharmacological properties, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Its unique structure and functional groups make it a subject of interest in research related to drug development and materials science. As with many indole derivatives, it may also display fluorescence, which can be advantageous in certain analytical applications.
Formula:C9H8INO
InChI:InChI=1S/C9H8INO/c1-12-6-2-3-9-7(4-6)8(10)5-11-9/h2-5,11H,1H3
InChI key:InChIKey=PKUXXVNWIXWXOE-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC=C(OC)C2)NC1
Synonyms:- 3-Iodo-5-methoxy-1H-indole
- 1H-Indole, 3-iodo-5-methoxy-
- 3-Iodo-5-methoxyindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.