
CAS 85094-88-8
:3-Ethynyl-1-methyl-1H-indole
Description:
3-Ethynyl-1-methyl-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of an ethynyl group at the 3-position and a methyl group at the 1-position distinguishes it from other indole derivatives. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The ethynyl group contributes to its reactivity, allowing for various chemical transformations, including coupling reactions. Additionally, 3-Ethynyl-1-methyl-1H-indole may exhibit fluorescence properties, making it useful in certain analytical applications. Its solubility can vary, often being soluble in organic solvents while having limited solubility in water. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C11H9N
InChI:InChI=1S/C11H9N/c1-3-9-8-12(2)11-7-5-4-6-10(9)11/h1,4-8H,2H3
InChI key:InChIKey=BFYPWSIBJDQYLF-UHFFFAOYSA-N
SMILES:C(#C)C=1C=2C(N(C)C1)=CC=CC2
Synonyms:- 3-Ethynyl-1-methyl-1H-indole
- 3-Ethynyl-1-methylindole
- 1H-Indole, 3-ethynyl-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.