CAS 850991-38-7

(5-Phenylpyridin-3-yl)boronic acid

Description:

(5-Phenylpyridin-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a phenyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents like methanol and dimethyl sulfoxide, and showing limited solubility in water. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Its structure contributes to its potential as a ligand in coordination chemistry and as a building block in the development of pharmaceuticals. Additionally, the presence of both the pyridine and phenyl groups can influence its electronic properties and reactivity, making it a subject of interest in materials science and drug discovery. Safety data should be consulted for handling, as boronic acids can be sensitive to moisture and may require specific storage conditions.

Formula: C₁₁H₁₀BNO₂

InChI: InChI=1/C11H10BNO2/c14-12(15)11-6-10(7-13-8-11)9-4-2-1-3-5-9/h1-8,14-15H

SMILES: c1ccc(cc1)c1cc(cnc1)B(O)O

Synonyms:

• boronic acid, B-(5-phenyl-3-pyridinyl)-
• 5-Phenyl-3-pyridinyl boronic acid, pinacol ester
• 5-Phenyl-3-Pyridinyl  Boronic  Acid

(5-Phenylpyridin-3-yl)boronic acid

CAS: 850991-38-7

Formula: C₁₁H₁₀BNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.0136

Ref: IN-DA004XK9

(5-Phenylpyridin-3-yl)boronic acid

CAS: 850991-38-7

(5-Phenylpyridin-3-yl)boronic acid

Purity: 98%

Molecular weight: 199.01g/mol

Ref: 54-OR82501

5-Phenyl-3-pyridine boronic acid

CAS: 850991-38-7

5-Phenyl-3-pyridine boronic acid is an intermediate and building block–boronic acid, heterocyclic compound-pyridine.

Formula: C₁₁H₁₀BNO₂

Color and Shape: Solid

Molecular weight: 199.01

Ref: TM-TNU0667

5-Phenyl-3-pyridinylboronic acid

CAS: 850991-38-7

Formula: C₁₁H₁₀BNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.02

Ref: 10-F225231