CAS 850991-38-7
:(5-Phenylpyridin-3-yl)boronic acid
Description:
(5-Phenylpyridin-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is further substituted with a phenyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents like methanol and dimethyl sulfoxide, and showing limited solubility in water. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Its structure contributes to its potential as a ligand in coordination chemistry and as a building block in the development of pharmaceuticals. Additionally, the presence of both the pyridine and phenyl groups can influence its electronic properties and reactivity, making it a subject of interest in materials science and drug discovery. Safety data should be consulted for handling, as boronic acids can be sensitive to moisture and may require specific storage conditions.
Formula:C11H10BNO2
InChI:InChI=1/C11H10BNO2/c14-12(15)11-6-10(7-13-8-11)9-4-2-1-3-5-9/h1-8,14-15H
SMILES:c1ccc(cc1)c1cc(cnc1)B(O)O
Synonyms:- boronic acid, B-(5-phenyl-3-pyridinyl)-
- 5-Phenyl-3-pyridinyl boronic acid, pinacol ester
- 5-Phenyl-3-Pyridinyl Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(5-Phenylpyridin-3-yl)boronic acid
CAS:Formula:C11H10BNO2Purity:98%Color and Shape:SolidMolecular weight:199.0136(5-Phenylpyridin-3-yl)boronic acid
CAS:(5-Phenylpyridin-3-yl)boronic acid
Purity:98%Molecular weight:199.01g/mol5-Phenyl-3-pyridine boronic acid
CAS:5-Phenyl-3-pyridine boronic acid is an intermediate and building block–boronic acid, heterocyclic compound-pyridine.Formula:C11H10BNO2Color and Shape:SolidMolecular weight:199.01Ref: TM-TNU0667
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire5-Phenyl-3-pyridinylboronic acid
CAS:Formula:C11H10BNO2Purity:98%Color and Shape:SolidMolecular weight:199.02



